C23H38O3 — CID 162949345
methyl (1S,4aR,5S,8aR)-5-(3,3-dimethyl-5-oxohexyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 162949345) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-5-(3,3-dimethyl-5-oxohexyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-5-(3,3-dimethyl-5-oxohexyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 162949345 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-5-(3,3-dimethyl-5-oxohexyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCC(C)(C)CC(C)=O |
| InChI | InChI=1S/C23H38O3/c1-16-9-10-19-22(5,12-8-13-23(19,6)20(25)26-7)18(16)11-14-21(3,4)15-17(2)24/h18-19H,1,8-15H2,2-7H3/t18-,19+,22+,23-/m0/s1 |
| InChIKey | XMGIBLOLCCXDOM-CSGUBPAMSA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|