C14H16O — CID 162949435
(E,3S)-tetradec-6-en-8,10,12-triyn-3-ol (PubChem CID 162949435) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (E,3S)-tetradec-6-en-8,10,12-triyn-3-ol.
| Compound Name | (E,3S)-tetradec-6-en-8,10,12-triyn-3-ol |
|---|---|
| PubChem CID | 162949435 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (E,3S)-tetradec-6-en-8,10,12-triyn-3-ol |
| SMILES | CC#CC#CC#C/C=C/CC[C@@H](O)CC |
| InChI | InChI=1S/C14H16O/c1-3-5-6-7-8-9-10-11-12-13-14(15)4-2/h10-11,14-15H,4,12-13H2,1-2H3/b11-10+/t14-/m0/s1 |
| InChIKey | FQCGENNZXNYXIL-VNDWYCCKSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|