C36H64O8 — CID 162949641
(3S,5R)-5-[6-[(2R,5R)-5-[(1S,4R)-1,4-dihydroxy-4-[(2R,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]hexyl]-3-(2-oxopropyl)oxolan-2-one (PubChem CID 162949641) has the molecular formula C36H64O8 and a molecular weight of 624.90 g/mol. Its IUPAC name is (3S,5R)-5-[6-[(2R,5R)-5-[(1S,4R)-1,4-dihydroxy-4-[(2R,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]hexyl]-3-(2-oxopropyl)oxolan-2-one.
| Compound Name | (3S,5R)-5-[6-[(2R,5R)-5-[(1S,4R)-1,4-dihydroxy-4-[(2R,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]hexyl]-3-(2-oxopropyl)oxolan-2-one |
|---|---|
| PubChem CID | 162949641 |
| Molecular Formula | C36H64O8 |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.46 |
| IUPAC Name | (3S,5R)-5-[6-[(2R,5R)-5-[(1S,4R)-1,4-dihydroxy-4-[(2R,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]hexyl]-3-(2-oxopropyl)oxolan-2-one |
| SMILES | CCCCCCCCCC[C@H](O)[C@@H]1CC[C@H]([C@H](O)CC[C@H](O)[C@H]2CC[C@@H](CCCCCC[C@@H]3C[C@@H](CC(C)=O)C(=O)O3)O2)O1 |
| InChI | InChI=1S/C36H64O8/c1-3-4-5-6-7-8-9-14-17-30(38)34-22-23-35(44-34)32(40)20-19-31(39)33-21-18-28(42-33)15-12-10-11-13-16-29-25-27(24-26(2)37)36(41)43-29/h27-35,38-40H,3-25H2,1-2H3/t27-,28-,29-,30+,31+,32-,33-,34+,35-/m1/s1 |
| InChIKey | YDCNXPCHVNMEDK-UPRAIKNCSA-N |
| XLogP | 6.73 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|