C25H42O12 — CID 162949743
methyl 4a,7-dihydroxy-7-methyl-6-octoxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162949743) has the molecular formula C25H42O12 and a molecular weight of 534.60 g/mol. Its IUPAC name is methyl 4a,7-dihydroxy-7-methyl-6-octoxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 4a,7-dihydroxy-7-methyl-6-octoxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162949743 |
| Molecular Formula | C25H42O12 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | methyl 4a,7-dihydroxy-7-methyl-6-octoxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CCCCCCCCOC1CC2(O)C(C(=O)OC)=COC(OC3OC(CO)C(O)C(O)C3O)C2C1(C)O |
| InChI | InChI=1S/C25H42O12/c1-4-5-6-7-8-9-10-34-16-11-25(32)14(21(30)33-3)13-35-23(20(25)24(16,2)31)37-22-19(29)18(28)17(27)15(12-26)36-22/h13,15-20,22-23,26-29,31-32H,4-12H2,1-3H3 |
| InChIKey | BJJIXMQSMBBRTG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|