C20H19NO5 — CID 162949981
6-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidenemethyl)-2,3-dimethoxybenzaldehyde (PubChem CID 162949981) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 6-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidenemethyl)-2,3-dimethoxybenzaldehyde.
| Compound Name | 6-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidenemethyl)-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 162949981 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 6-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidenemethyl)-2,3-dimethoxybenzaldehyde |
| SMILES | COc1ccc(C=C2NCCc3cc4c(cc32)OCO4)c(C=O)c1OC |
| InChI | InChI=1S/C20H19NO5/c1-23-17-4-3-12(15(10-22)20(17)24-2)7-16-14-9-19-18(25-11-26-19)8-13(14)5-6-21-16/h3-4,7-10,21H,5-6,11H2,1-2H3 |
| InChIKey | NMZLYCCNMOSMED-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|