C14H20O5 — CID 162950363
[(1R,4aR,7R,7aS)-1-acetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-yl]methyl acetate (PubChem CID 162950363) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is [(1R,4aR,7R,7aS)-1-acetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-yl]methyl acetate.
| Compound Name | [(1R,4aR,7R,7aS)-1-acetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-yl]methyl acetate |
|---|---|
| PubChem CID | 162950363 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [(1R,4aR,7R,7aS)-1-acetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CO[C@H](OC(C)=O)[C@H]2[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C14H20O5/c1-8-4-5-12-11(6-17-9(2)15)7-18-14(13(8)12)19-10(3)16/h7-8,12-14H,4-6H2,1-3H3/t8-,12+,13+,14-/m1/s1 |
| InChIKey | PWSAKIKRNLLDNQ-DGJRKYIQSA-N |
| XLogP | 2.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |