C20H28O4 — CID 162951526
(5,8a-dimethyl-3-methylidene-2-oxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-8-yl) 2-methylbutanoate (PubChem CID 162951526) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (5,8a-dimethyl-3-methylidene-2-oxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-8-yl) 2-methylbutanoate.
| Compound Name | (5,8a-dimethyl-3-methylidene-2-oxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-8-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 162951526 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (5,8a-dimethyl-3-methylidene-2-oxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-8-yl) 2-methylbutanoate |
| SMILES | C=C1C(=O)OC2CC3(C)C(=C(C)CCC3OC(=O)C(C)CC)CC12 |
| InChI | InChI=1S/C20H28O4/c1-6-11(2)18(21)24-17-8-7-12(3)15-9-14-13(4)19(22)23-16(14)10-20(15,17)5/h11,14,16-17H,4,6-10H2,1-3,5H3 |
| InChIKey | ODZCVPMDHQHNOP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|