C23H38O4 — CID 162951810
[(4aR,5S,6R,8aR)-5-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate (PubChem CID 162951810) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is [(4aR,5S,6R,8aR)-5-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [(4aR,5S,6R,8aR)-5-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162951810 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | [(4aR,5S,6R,8aR)-5-[2-[(3R,5R)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES | CO[C@H]1C[C@@H](CC[C@@]2(C)[C@H](C)CC[C@@]3(C)C(COC(C)=O)=CCC[C@H]23)CO1 |
| InChI | InChI=1S/C23H38O4/c1-16-9-11-23(4)19(15-26-17(2)24)7-6-8-20(23)22(16,3)12-10-18-13-21(25-5)27-14-18/h7,16,18,20-21H,6,8-15H2,1-5H3/t16-,18-,20-,21-,22+,23+/m1/s1 |
| InChIKey | FAOCUOODXKJAGO-YPXNVGRLSA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|