C15H20O3 — CID 162951922
(3aS,5aS,8S,8aR,8bS)-5a,8-dimethyl-3-methylidene-2-oxo-4,5,6,7,8a,8b-hexahydro-3aH-cyclopenta[g][1]benzofuran-8-carbaldehyde (PubChem CID 162951922) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3aS,5aS,8S,8aR,8bS)-5a,8-dimethyl-3-methylidene-2-oxo-4,5,6,7,8a,8b-hexahydro-3aH-cyclopenta[g][1]benzofuran-8-carbaldehyde.
| Compound Name | (3aS,5aS,8S,8aR,8bS)-5a,8-dimethyl-3-methylidene-2-oxo-4,5,6,7,8a,8b-hexahydro-3aH-cyclopenta[g][1]benzofuran-8-carbaldehyde |
|---|---|
| PubChem CID | 162951922 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3aS,5aS,8S,8aR,8bS)-5a,8-dimethyl-3-methylidene-2-oxo-4,5,6,7,8a,8b-hexahydro-3aH-cyclopenta[g][1]benzofuran-8-carbaldehyde |
| SMILES | C=C1C(=O)O[C@@H]2[C@@H]3[C@@](C)(CC[C@@H]12)CC[C@]3(C)C=O |
| InChI | InChI=1S/C15H20O3/c1-9-10-4-5-14(2)6-7-15(3,8-16)12(14)11(10)18-13(9)17/h8,10-12H,1,4-7H2,2-3H3/t10-,11-,12+,14-,15+/m0/s1 |
| InChIKey | OOHSZMHOXQXINH-ZZVJUGKHSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|