C21H20O14S — CID 162952042
[(2S,3R,4S,5S,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 162952042) has the molecular formula C21H20O14S and a molecular weight of 528.44 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2S,3R,4S,5S,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 162952042 |
| Molecular Formula | C21H20O14S |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=c1c(O[C@@H]2O[C@@H](COS(=O)(=O)O)[C@H](O)[C@H](O)[C@@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O14S/c22-9-3-1-8(2-4-9)19-20(16(26)14-11(24)5-10(23)6-12(14)33-19)35-21-18(28)17(27)15(25)13(34-21)7-32-36(29,30)31/h1-6,13,15,17-18,21-25,27-28H,7H2,(H,29,30,31)/t13-,15-,17-,18-,21-/m0/s1 |
| InChIKey | WYHOAUOZPBCWPP-KBBVGDAESA-N |
| XLogP | -0.42 |
| TPSA | 233.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|