C27H42O4 — CID 162952693
(1R,2R,8R,11R,12R,15S,16R)-2,7,7,11,12-pentamethyl-15-[(2R)-2-methyl-5-oxooxolan-2-yl]-6-oxatetracyclo[9.7.0.02,8.012,16]octadecan-5-one (PubChem CID 162952693) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is (1R,2R,8R,11R,12R,15S,16R)-2,7,7,11,12-pentamethyl-15-[(2R)-2-methyl-5-oxooxolan-2-yl]-6-oxatetracyclo[9.7.0.02,8.012,16]octadecan-5-one.
| Compound Name | (1R,2R,8R,11R,12R,15S,16R)-2,7,7,11,12-pentamethyl-15-[(2R)-2-methyl-5-oxooxolan-2-yl]-6-oxatetracyclo[9.7.0.02,8.012,16]octadecan-5-one |
|---|---|
| PubChem CID | 162952693 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (1R,2R,8R,11R,12R,15S,16R)-2,7,7,11,12-pentamethyl-15-[(2R)-2-methyl-5-oxooxolan-2-yl]-6-oxatetracyclo[9.7.0.02,8.012,16]octadecan-5-one |
| SMILES | CC1(C)OC(=O)CC[C@]2(C)[C@H]3CC[C@@H]4[C@@H]([C@@]5(C)CCC(=O)O5)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C27H42O4/c1-23(2)19-10-15-26(5)20(24(19,3)13-11-21(28)30-23)8-7-17-18(9-14-25(17,26)4)27(6)16-12-22(29)31-27/h17-20H,7-16H2,1-6H3/t17-,18+,19+,20-,24+,25-,26-,27-/m1/s1 |
| InChIKey | JAYMFFBUWLQDCM-YHHBCDBUSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |