C27H28N2O6 — CID 162953122
2-[2-[[2-amino-5-(2-oxoethyl)-4-pyridinyl]methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl 2-methylbut-2-enoate (PubChem CID 162953122) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[2-[[2-amino-5-(2-oxoethyl)-4-pyridinyl]methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl 2-methylbut-2-enoate.
| Compound Name | 2-[2-[[2-amino-5-(2-oxoethyl)-4-pyridinyl]methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162953122 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[2-[[2-amino-5-(2-oxoethyl)-4-pyridinyl]methyl]-7-oxo-3H-furo[3,2-g]chromen-2-yl]propan-2-yl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC(C)(C)C1(Cc2cc(N)ncc2CC=O)Cc2cc3ccc(=O)oc3cc2O1 |
| InChI | InChI=1S/C27H28N2O6/c1-5-16(2)25(32)35-26(3,4)27(13-19-11-23(28)29-15-18(19)8-9-30)14-20-10-17-6-7-24(31)33-21(17)12-22(20)34-27/h5-7,9-12,15H,8,13-14H2,1-4H3,(H2,28,29) |
| InChIKey | DWHHKRJFFJHFGD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|