C19H25NO — CID 162953238
(2R,6S,10R,11S)-11-but-1-en-3-ynyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol (PubChem CID 162953238) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (2R,6S,10R,11S)-11-but-1-en-3-ynyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol.
| Compound Name | (2R,6S,10R,11S)-11-but-1-en-3-ynyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 162953238 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (2R,6S,10R,11S)-11-but-1-en-3-ynyl-2-pent-2-en-4-ynyl-1-azaspiro[5.5]undecan-10-ol |
| SMILES | C#CC=CC[C@H]1CCC[C@@]2(CCC[C@@H](O)C2C=CC#C)N1 |
| InChI | InChI=1S/C19H25NO/c1-3-5-7-10-16-11-8-14-19(20-16)15-9-13-18(21)17(19)12-6-4-2/h1-2,5-7,12,16-18,20-21H,8-11,13-15H2/t16-,17?,18+,19-/m0/s1 |
| InChIKey | JBRYWENFVHQBGY-GWAVRBHSSA-N |
| XLogP | 2.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|