C30H48O5 — CID 162953279
(1S,4S,5R,6S,9S,10R,12R,14R)-4-decoxy-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 162953279) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is (1S,4S,5R,6S,9S,10R,12R,14R)-4-decoxy-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | (1S,4S,5R,6S,9S,10R,12R,14R)-4-decoxy-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 162953279 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | (1S,4S,5R,6S,9S,10R,12R,14R)-4-decoxy-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | CCCCCCCCCCO[C@H]1C(C)=C[C@]23C(=O)[C@@H](C=C(CO)[C@H](O)[C@@]12O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H48O5/c1-6-7-8-9-10-11-12-13-14-35-27-19(2)17-29-20(3)15-23-24(28(23,4)5)22(26(29)33)16-21(18-31)25(32)30(27,29)34/h16-17,20,22-25,27,31-32,34H,6-15,18H2,1-5H3/t20-,22+,23-,24+,25+,27+,29+,30-/m1/s1 |
| InChIKey | AXDIYVFJMQKUET-GUBBNLRRSA-N |
| XLogP | 4.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|