C37H64 — CID 162954066
(3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidene-21-propan-2-yltricosa-1,11,21-triene (PubChem CID 162954066) has the molecular formula C37H64 and a molecular weight of 508.92 g/mol. Its IUPAC name is (3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidene-21-propan-2-yltricosa-1,11,21-triene.
| Compound Name | (3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidene-21-propan-2-yltricosa-1,11,21-triene |
|---|---|
| PubChem CID | 162954066 |
| Molecular Formula | C37H64 |
| Molecular Weight | 508.92 g/mol |
| Exact Mass | 508.50 |
| IUPAC Name | (3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidene-21-propan-2-yltricosa-1,11,21-triene |
| SMILES | C=C[C@@](C)(/C=C/[C@H](C)CC[C@@H](C)C(=C)CC[C@@H](C)/C(=C\C)C(C)C)CC[C@@H](C)C(=C)CC[C@@H](C)C(=C)C |
| InChI | InChI=1S/C37H64/c1-15-36(28(5)6)35(13)22-21-32(10)31(9)18-17-29(7)23-25-37(14,16-2)26-24-34(12)33(11)20-19-30(8)27(3)4/h15-16,23,25,28-31,34-35H,2-3,10-11,17-22,24,26H2,1,4-9,12-14H3/b25-23+,36-15-/t29-,30-,31-,34-,35-,37+/m1/s1 |
| InChIKey | MKMRIIIDLBYFBR-AYGLTHETSA-N |
| XLogP | 12.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.92 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|