C13H24O8 — CID 162954139
methyl (3S,5S)-5-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoate (PubChem CID 162954139) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (3S,5S)-5-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoate.
| Compound Name | methyl (3S,5S)-5-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoate |
|---|---|
| PubChem CID | 162954139 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | methyl (3S,5S)-5-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoate |
| SMILES | COC(=O)C[C@H](C[C@H](C)O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O8/c1-6(15)3-7(4-9(16)20-2)13-12(19)11(18)10(17)8(5-14)21-13/h6-8,10-15,17-19H,3-5H2,1-2H3/t6-,7-,8+,10+,11-,12+,13-/m0/s1 |
| InChIKey | HIXHJQYDTOCADR-MKUGJQNMSA-N |
| XLogP | -2.22 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |