C15H18O2 — CID 162954903
(2E,8E,10R)-10-hydroxypentadeca-2,8-dien-4,6-diynal (PubChem CID 162954903) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2E,8E,10R)-10-hydroxypentadeca-2,8-dien-4,6-diynal.
| Compound Name | (2E,8E,10R)-10-hydroxypentadeca-2,8-dien-4,6-diynal |
|---|---|
| PubChem CID | 162954903 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2E,8E,10R)-10-hydroxypentadeca-2,8-dien-4,6-diynal |
| SMILES | CCCCC[C@@H](O)/C=C/C#CC#C/C=C/C=O |
| InChI | InChI=1S/C15H18O2/c1-2-3-9-12-15(17)13-10-7-5-4-6-8-11-14-16/h8,10-11,13-15,17H,2-3,9,12H2,1H3/b11-8+,13-10+/t15-/m1/s1 |
| InChIKey | DKHGWZAGTJTORV-KZLMLFTGSA-N |
| XLogP | 2.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|