(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid

C12H22O3 — CID 162954907

IUPAC(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid
SMILESCCC(/C=C/[C@@](C)(O)CC(=O)O)C(C)C
InChIInChI=1S/C12H22O3/c1-5-10(9(2)3)6-7-12(4,15)8-11(13)14/h6-7,9-10,15H,5,8H2,1-4H3,(H,13,14)/b7-6+/t10?,12-/m1/s1
InChIKeySZNQPFAEOXCITM-HXWSPDILSA-N
MW214.30 g/mol
LogP2.45
Rot. Bonds6

About (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid

(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid (PubChem CID 162954907) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid.

Molecular Properties

Compound Name(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid
PubChem CID162954907
Molecular FormulaC12H22O3
Molecular Weight214.30 g/mol
Exact Mass214.16
IUPAC Name(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid
SMILESCCC(/C=C/[C@@](C)(O)CC(=O)O)C(C)C
InChIInChI=1S/C12H22O3/c1-5-10(9(2)3)6-7-12(4,15)8-11(13)14/h6-7,9-10,15H,5,8H2,1-4H3,(H,13,14)/b7-6+/t10?,12-/m1/s1
InChIKeySZNQPFAEOXCITM-HXWSPDILSA-N
XLogP2.45
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.30
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid?
The IUPAC name of (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid (CID 162954907) is (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid.
What is the SMILES notation for (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid?
The canonical SMILES for (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid is CCC(/C=C/[C@@](C)(O)CC(=O)O)C(C)C.
What is the InChIKey of (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid?
The InChIKey is SZNQPFAEOXCITM-HXWSPDILSA-N. The full InChI is InChI=1S/C12H22O3/c1-5-10(9(2)3)6-7-12(4,15)8-11(13)14/h6-7,9-10,15H,5,8H2,1-4H3,(H,13,14)/b7-6+/t10?,12-/m1/s1.
What are the key properties of (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid?
(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid has a molecular weight of 214.30 g/mol, XLogP of 2.45, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid is sourced from PubChem (CID 162954907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).