C12H22O3 — CID 162954907
(E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid (PubChem CID 162954907) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid.
| Compound Name | (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid |
|---|---|
| PubChem CID | 162954907 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E,3S,6S)-6-ethyl-3-hydroxy-3,7-dimethyloct-4-enoic acid |
| SMILES | CCC(/C=C/[C@@](C)(O)CC(=O)O)C(C)C |
| InChI | InChI=1S/C12H22O3/c1-5-10(9(2)3)6-7-12(4,15)8-11(13)14/h6-7,9-10,15H,5,8H2,1-4H3,(H,13,14)/b7-6+/t10?,12-/m1/s1 |
| InChIKey | SZNQPFAEOXCITM-HXWSPDILSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|