C24H36O4 — CID 162955119
[(1Z,3Z,5R,7E,11E)-5-acetyloxy-7,11-dimethyl-4-propan-2-ylcyclotetradeca-1,3,7,11-tetraen-1-yl]methyl acetate (PubChem CID 162955119) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [(1Z,3Z,5R,7E,11E)-5-acetyloxy-7,11-dimethyl-4-propan-2-ylcyclotetradeca-1,3,7,11-tetraen-1-yl]methyl acetate.
| Compound Name | [(1Z,3Z,5R,7E,11E)-5-acetyloxy-7,11-dimethyl-4-propan-2-ylcyclotetradeca-1,3,7,11-tetraen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162955119 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(1Z,3Z,5R,7E,11E)-5-acetyloxy-7,11-dimethyl-4-propan-2-ylcyclotetradeca-1,3,7,11-tetraen-1-yl]methyl acetate |
| SMILES | CC(=O)OC/C1=C\C=C(\C(C)C)[C@H](OC(C)=O)C/C(C)=C/CC/C(C)=C/CC1 |
| InChI | InChI=1S/C24H36O4/c1-17(2)23-14-13-22(16-27-20(5)25)12-8-10-18(3)9-7-11-19(4)15-24(23)28-21(6)26/h10-11,13-14,17,24H,7-9,12,15-16H2,1-6H3/b18-10+,19-11+,22-13-,23-14-/t24-/m1/s1 |
| InChIKey | NNSUTKYOCUOXJH-FIMIFSETSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|