C20H26O6 — CID 162955556
[(2-formyl-1,6-dimethylcyclohex-2-en-1-yl)-(2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl)methyl] 2-methylbut-2-enoate (PubChem CID 162955556) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(2-formyl-1,6-dimethylcyclohex-2-en-1-yl)-(2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl)methyl] 2-methylbut-2-enoate.
| Compound Name | [(2-formyl-1,6-dimethylcyclohex-2-en-1-yl)-(2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl)methyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162955556 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(2-formyl-1,6-dimethylcyclohex-2-en-1-yl)-(2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl)methyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC(C1=C(C)C(=O)OC1O)C1(C)C(C=O)=CCCC1C |
| InChI | InChI=1S/C20H26O6/c1-6-11(2)17(22)25-16(15-13(4)18(23)26-19(15)24)20(5)12(3)8-7-9-14(20)10-21/h6,9-10,12,16,19,24H,7-8H2,1-5H3 |
| InChIKey | JUWNQGFIHXLZHN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|