C16H20N2O3 — CID 162955673
3-benzyl-3-methoxy-6-(2-methylpropylidene)piperazine-2,5-dione (PubChem CID 162955673) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-benzyl-3-methoxy-6-(2-methylpropylidene)piperazine-2,5-dione.
| Compound Name | 3-benzyl-3-methoxy-6-(2-methylpropylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 162955673 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-benzyl-3-methoxy-6-(2-methylpropylidene)piperazine-2,5-dione |
| SMILES | COC1(Cc2ccccc2)NC(=O)C(=CC(C)C)NC1=O |
| InChI | InChI=1S/C16H20N2O3/c1-11(2)9-13-14(19)18-16(21-3,15(20)17-13)10-12-7-5-4-6-8-12/h4-9,11H,10H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | KGNQLIBQXKIUBX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|