C27H44O — CID 162955790
(1E,5Z,9E,12R,13R)-13-ethoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene (PubChem CID 162955790) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is (1E,5Z,9E,12R,13R)-13-ethoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene.
| Compound Name | (1E,5Z,9E,12R,13R)-13-ethoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene |
|---|---|
| PubChem CID | 162955790 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | (1E,5Z,9E,12R,13R)-13-ethoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene |
| SMILES | C=C(CCC=C(C)C)[C@H]1C/C=C(\C)CC/C=C(/C)CC/C=C(\C)C[C@H]1OCC |
| InChI | InChI=1S/C27H44O/c1-8-28-27-20-24(6)16-11-14-22(4)13-10-15-23(5)18-19-26(27)25(7)17-9-12-21(2)3/h12-13,16,18,26-27H,7-11,14-15,17,19-20H2,1-6H3/b22-13-,23-18+,24-16+/t26-,27-/m1/s1 |
| InChIKey | WMCFQVVNOGHBSE-CLRKCOOUSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|