C29H44O5 — CID 162955979
(3aR,5R,6R,7aR)-6-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-6-hydroxy-5-(2-hydroxy-2-methylpropyl)-3a,7a-dimethyl-2,3,5,7-tetrahydro-1H-inden-4-one (PubChem CID 162955979) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is (3aR,5R,6R,7aR)-6-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-6-hydroxy-5-(2-hydroxy-2-methylpropyl)-3a,7a-dimethyl-2,3,5,7-tetrahydro-1H-inden-4-one.
| Compound Name | (3aR,5R,6R,7aR)-6-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-6-hydroxy-5-(2-hydroxy-2-methylpropyl)-3a,7a-dimethyl-2,3,5,7-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 162955979 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | (3aR,5R,6R,7aR)-6-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-6-hydroxy-5-(2-hydroxy-2-methylpropyl)-3a,7a-dimethyl-2,3,5,7-tetrahydro-1H-inden-4-one |
| SMILES | COc1cc(C)c(OC)c(CC=C(C)C[C@@]2(O)C[C@@]3(C)CCC[C@@]3(C)C(=O)[C@@H]2CC(C)(C)O)c1 |
| InChI | InChI=1S/C29H44O5/c1-19(10-11-21-15-22(33-7)14-20(2)24(21)34-8)16-29(32)18-27(5)12-9-13-28(27,6)25(30)23(29)17-26(3,4)31/h10,14-15,23,31-32H,9,11-13,16-18H2,1-8H3/t23-,27+,28-,29+/m0/s1 |
| InChIKey | PWASEOYBBJYFKS-AVUDXFIYSA-N |
| XLogP | 5.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|