C20H34O3 — CID 162956324
(1R,4aS,5R,6S)-5-[(3R)-5-hydroxy-3-methylpentyl]-1,5,6-trimethyl-2,3,4,4a,6,7-hexahydronaphthalene-1-carboxylic acid (PubChem CID 162956324) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,4aS,5R,6S)-5-[(3R)-5-hydroxy-3-methylpentyl]-1,5,6-trimethyl-2,3,4,4a,6,7-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | (1R,4aS,5R,6S)-5-[(3R)-5-hydroxy-3-methylpentyl]-1,5,6-trimethyl-2,3,4,4a,6,7-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 162956324 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,4aS,5R,6S)-5-[(3R)-5-hydroxy-3-methylpentyl]-1,5,6-trimethyl-2,3,4,4a,6,7-hexahydronaphthalene-1-carboxylic acid |
| SMILES | C[C@@H](CCO)CC[C@@]1(C)[C@@H]2CCC[C@@](C)(C(=O)O)C2=CC[C@@H]1C |
| InChI | InChI=1S/C20H34O3/c1-14(10-13-21)9-12-19(3)15(2)7-8-17-16(19)6-5-11-20(17,4)18(22)23/h8,14-16,21H,5-7,9-13H2,1-4H3,(H,22,23)/t14-,15+,16-,19-,20-/m1/s1 |
| InChIKey | PHBNWBMJJWMICH-KMJHBWPFSA-N |
| XLogP | 4.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|