C19H28O2 — CID 162956498
(2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-ylidene]acetic acid (PubChem CID 162956498) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-ylidene]acetic acid.
| Compound Name | (2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-ylidene]acetic acid |
|---|---|
| PubChem CID | 162956498 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-ylidene]acetic acid |
| SMILES | CC1(C)CCC[C@@]2(C)[C@@H]3CC/C(=C/C(=O)O)CC3=CC[C@H]12 |
| InChI | InChI=1S/C19H28O2/c1-18(2)9-4-10-19(3)15-7-5-13(12-17(20)21)11-14(15)6-8-16(18)19/h6,12,15-16H,4-5,7-11H2,1-3H3,(H,20,21)/b13-12-/t15-,16-,19+/m1/s1 |
| InChIKey | HHZXUCYNPCWYJI-XZXHNHHKSA-N |
| XLogP | 4.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|