C31H48O6 — CID 162956965
1-O-methyl 3-O-[4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxooxolan-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanedioate (PubChem CID 162956965) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is 1-O-methyl 3-O-[4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxooxolan-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanedioate.
| Compound Name | 1-O-methyl 3-O-[4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxooxolan-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanedioate |
|---|---|
| PubChem CID | 162956965 |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | 1-O-methyl 3-O-[4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxooxolan-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanedioate |
| SMILES | COC(=O)CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C(C4(C)CCC(=O)O4)CCC23C)C1(C)C |
| InChI | InChI=1S/C31H48O6/c1-27(2)21-11-16-30(5)22(28(21,3)14-12-23(27)36-26(34)18-25(33)35-7)9-8-19-20(10-15-29(19,30)4)31(6)17-13-24(32)37-31/h19-23H,8-18H2,1-7H3 |
| InChIKey | ANHOWKNWMOVOFJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|