About 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid
3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid (PubChem CID 162957225) has the molecular formula C10H13N3O6
and a molecular weight of 271.23 g/mol. Its IUPAC name is 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid |
| PubChem CID | 162957225 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid |
| SMILES | NC1C(C(=O)O)OC(n2cccnc2=O)C(O)C1O |
| InChI | InChI=1S/C10H13N3O6/c11-4-5(14)6(15)8(19-7(4)9(16)17)13-3-1-2-12-10(13)18/h1-8,14-15H,11H2,(H,16,17) |
| InChIKey | XOTAPVZHVUJTAQ-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid?
The IUPAC name of 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid (CID 162957225) is 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid.
What is the SMILES notation for 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid?
The canonical SMILES for 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid is NC1C(C(=O)O)OC(n2cccnc2=O)C(O)C1O.
What is the InChIKey of 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid?
The InChIKey is XOTAPVZHVUJTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O6/c11-4-5(14)6(15)8(19-7(4)9(16)17)13-3-1-2-12-10(13)18/h1-8,14-15H,11H2,(H,16,17).
What are the key properties of 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid?
3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid has a molecular weight of 271.23 g/mol, XLogP of -2.73, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5-dihydroxy-6-(2-oxopyrimidin-1-yl)oxane-2-carboxylic acid is sourced from PubChem (CID 162957225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).