C21H28O3 — CID 162957317
(3R,4R,5S)-3-hexadeca-11,15-dien-7,9-diynyl-4-hydroxy-5-methyloxolan-2-one (PubChem CID 162957317) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (3R,4R,5S)-3-hexadeca-11,15-dien-7,9-diynyl-4-hydroxy-5-methyloxolan-2-one.
| Compound Name | (3R,4R,5S)-3-hexadeca-11,15-dien-7,9-diynyl-4-hydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 162957317 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (3R,4R,5S)-3-hexadeca-11,15-dien-7,9-diynyl-4-hydroxy-5-methyloxolan-2-one |
| SMILES | C=CCCC=CC#CC#CCCCCCC[C@H]1C(=O)O[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C21H28O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-20(22)18(2)24-21(19)23/h3,6-7,18-20,22H,1,4-5,12-17H2,2H3/t18-,19+,20-/m0/s1 |
| InChIKey | BWHZURYINQNHCL-ZCNNSNEGSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|