C15H22O3 — CID 162957513
3-[(3E,5R)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one (PubChem CID 162957513) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-[(3E,5R)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one.
| Compound Name | 3-[(3E,5R)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162957513 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3-[(3E,5R)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one |
| SMILES | CC(C)=CC[C@@H](O)/C(C)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C15H22O3/c1-11(2)7-8-14(16)12(3)5-4-6-13-9-15(17)18-10-13/h5,7,9,14,16H,4,6,8,10H2,1-3H3/b12-5+/t14-/m1/s1 |
| InChIKey | HJPSBDPCOCVCKE-IMBBRHANSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|