C24H32O9 — CID 162957692
[11,12-dihydroxy-3,10-dimethyl-3-(3-methyl-5-oxo-2H-furan-2-yl)-7-oxo-6,13-dioxatetracyclo[7.5.0.01,5.02,12]tetradecan-8-yl] 2-methylbutanoate (PubChem CID 162957692) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [11,12-dihydroxy-3,10-dimethyl-3-(3-methyl-5-oxo-2H-furan-2-yl)-7-oxo-6,13-dioxatetracyclo[7.5.0.01,5.02,12]tetradecan-8-yl] 2-methylbutanoate.
| Compound Name | [11,12-dihydroxy-3,10-dimethyl-3-(3-methyl-5-oxo-2H-furan-2-yl)-7-oxo-6,13-dioxatetracyclo[7.5.0.01,5.02,12]tetradecan-8-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 162957692 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [11,12-dihydroxy-3,10-dimethyl-3-(3-methyl-5-oxo-2H-furan-2-yl)-7-oxo-6,13-dioxatetracyclo[7.5.0.01,5.02,12]tetradecan-8-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C(=O)OC2CC(C)(C3OC(=O)C=C3C)C3C4(O)OCC23C1C(C)C4O |
| InChI | InChI=1S/C24H32O9/c1-6-10(2)19(27)33-16-15-12(4)17(26)24(29)21-22(5,18-11(3)7-14(25)32-18)8-13(31-20(16)28)23(15,21)9-30-24/h7,10,12-13,15-18,21,26,29H,6,8-9H2,1-5H3 |
| InChIKey | JDSMNGUJOKFCLK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|