C28H38O9 — CID 162957694
[(1E,3Z,4S,6E,9S,10E)-4,9-diacetyloxy-3-(acetyloxymethylidene)-7-formyl-11,15-dimethylhexadeca-1,6,10,14-tetraenyl] acetate (PubChem CID 162957694) has the molecular formula C28H38O9 and a molecular weight of 518.60 g/mol. Its IUPAC name is [(1E,3Z,4S,6E,9S,10E)-4,9-diacetyloxy-3-(acetyloxymethylidene)-7-formyl-11,15-dimethylhexadeca-1,6,10,14-tetraenyl] acetate.
| Compound Name | [(1E,3Z,4S,6E,9S,10E)-4,9-diacetyloxy-3-(acetyloxymethylidene)-7-formyl-11,15-dimethylhexadeca-1,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 162957694 |
| Molecular Formula | C28H38O9 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [(1E,3Z,4S,6E,9S,10E)-4,9-diacetyloxy-3-(acetyloxymethylidene)-7-formyl-11,15-dimethylhexadeca-1,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)O/C=C(/C=C/OC(C)=O)[C@H](C/C=C(/C=O)C[C@@H](/C=C(\C)CCC=C(C)C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C28H38O9/c1-19(2)9-8-10-20(3)15-27(36-23(6)32)16-25(17-29)11-12-28(37-24(7)33)26(18-35-22(5)31)13-14-34-21(4)30/h9,11,13-15,17-18,27-28H,8,10,12,16H2,1-7H3/b14-13+,20-15+,25-11+,26-18-/t27-,28+/m1/s1 |
| InChIKey | XZOGRCCLWBRJHG-YYLLKCDISA-N |
| XLogP | 4.97 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|