C23H34O5 — CID 162957788
(1S,3S,4aS,7Z,11aR)-1,3-dimethoxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,11a-tetrahydro-1H-cyclonona[c]pyran-9-one (PubChem CID 162957788) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (1S,3S,4aS,7Z,11aR)-1,3-dimethoxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,11a-tetrahydro-1H-cyclonona[c]pyran-9-one.
| Compound Name | (1S,3S,4aS,7Z,11aR)-1,3-dimethoxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,11a-tetrahydro-1H-cyclonona[c]pyran-9-one |
|---|---|
| PubChem CID | 162957788 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1S,3S,4aS,7Z,11aR)-1,3-dimethoxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,11a-tetrahydro-1H-cyclonona[c]pyran-9-one |
| SMILES | C=C1CC(=O)/C=C(/C)CC[C@@H]2C(=C/C=C/C(C)(C)OC)[C@@H](OC)O[C@H](OC)[C@@H]12 |
| InChI | InChI=1S/C23H34O5/c1-15-10-11-18-19(9-8-12-23(3,4)27-7)21(25-5)28-22(26-6)20(18)16(2)14-17(24)13-15/h8-9,12-13,18,20-22H,2,10-11,14H2,1,3-7H3/b12-8+,15-13-,19-9?/t18-,20+,21+,22+/m1/s1 |
| InChIKey | SWDXYFIXGCHEQG-KRKYESDESA-N |
| XLogP | 4.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|