C15H22O2 — CID 162958176
(1S,4R,8S,9R)-1,4,6-trimethylspiro[3-oxatricyclo[6.2.1.04,9]undec-6-ene-5,1'-cyclopropane]-8-ol (PubChem CID 162958176) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1S,4R,8S,9R)-1,4,6-trimethylspiro[3-oxatricyclo[6.2.1.04,9]undec-6-ene-5,1'-cyclopropane]-8-ol.
| Compound Name | (1S,4R,8S,9R)-1,4,6-trimethylspiro[3-oxatricyclo[6.2.1.04,9]undec-6-ene-5,1'-cyclopropane]-8-ol |
|---|---|
| PubChem CID | 162958176 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1S,4R,8S,9R)-1,4,6-trimethylspiro[3-oxatricyclo[6.2.1.04,9]undec-6-ene-5,1'-cyclopropane]-8-ol |
| SMILES | CC1=C[C@@]2(O)C[C@@]3(C)CO[C@](C)([C@@H]2C3)C12CC2 |
| InChI | InChI=1S/C15H22O2/c1-10-6-15(16)8-12(2)7-11(15)13(3,17-9-12)14(10)4-5-14/h6,11,16H,4-5,7-9H2,1-3H3/t11-,12-,13+,15+/m0/s1 |
| InChIKey | IRAZMEBBMCFGMQ-RMRHIDDWSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|