C13H15N3O4S — CID 162958710
cyclopropyl-(9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl)methanone (PubChem CID 162958710) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is cyclopropyl-(9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl)methanone.
| Compound Name | cyclopropyl-(9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl)methanone |
|---|---|
| PubChem CID | 162958710 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | cyclopropyl-(9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl)methanone |
| SMILES | O=C(C1CC1)N1CC2NS(=O)(=O)c3cccnc3OC2C1 |
| InChI | InChI=1S/C13H15N3O4S/c17-13(8-3-4-8)16-6-9-10(7-16)20-12-11(2-1-5-14-12)21(18,19)15-9/h1-2,5,8-10,15H,3-4,6-7H2 |
| InChIKey | HDGLBAFVQXTRLX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |