C28H41NO2 — CID 162958882
3-[[(1S,2R,4aR,4bR,7S,8R,8aR,10aR)-7-hydroxy-1,2,4a,8,8a-pentamethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl]-1H-indol-6-ol (PubChem CID 162958882) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is 3-[[(1S,2R,4aR,4bR,7S,8R,8aR,10aR)-7-hydroxy-1,2,4a,8,8a-pentamethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl]-1H-indol-6-ol.
| Compound Name | 3-[[(1S,2R,4aR,4bR,7S,8R,8aR,10aR)-7-hydroxy-1,2,4a,8,8a-pentamethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl]-1H-indol-6-ol |
|---|---|
| PubChem CID | 162958882 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 3-[[(1S,2R,4aR,4bR,7S,8R,8aR,10aR)-7-hydroxy-1,2,4a,8,8a-pentamethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl]-1H-indol-6-ol |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@H]3CC[C@H](O)[C@H](C)[C@]3(C)CC[C@@H]2[C@@]1(C)Cc1c[nH]c2cc(O)ccc12 |
| InChI | InChI=1S/C28H41NO2/c1-17-10-12-27(4)24-9-8-23(31)18(2)26(24,3)13-11-25(27)28(17,5)15-19-16-29-22-14-20(30)6-7-21(19)22/h6-7,14,16-18,23-25,29-31H,8-13,15H2,1-5H3/t17-,18+,23+,24+,25+,26+,27+,28+/m1/s1 |
| InChIKey | NWKNHNUJGTXAFZ-COFICUORSA-N |
| XLogP | 6.68 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |