C37H68O8 — CID 162959216
(2R)-2-methyl-4-[(2S,6S,11R,17R)-2,6,11,17-tetrahydroxy-17-[(2S,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]heptadecyl]-2H-furan-5-one (PubChem CID 162959216) has the molecular formula C37H68O8 and a molecular weight of 640.94 g/mol. Its IUPAC name is (2R)-2-methyl-4-[(2S,6S,11R,17R)-2,6,11,17-tetrahydroxy-17-[(2S,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]heptadecyl]-2H-furan-5-one.
| Compound Name | (2R)-2-methyl-4-[(2S,6S,11R,17R)-2,6,11,17-tetrahydroxy-17-[(2S,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]heptadecyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162959216 |
| Molecular Formula | C37H68O8 |
| Molecular Weight | 640.94 g/mol |
| Exact Mass | 640.49 |
| IUPAC Name | (2R)-2-methyl-4-[(2S,6S,11R,17R)-2,6,11,17-tetrahydroxy-17-[(2S,5S)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]heptadecyl]-2H-furan-5-one |
| SMILES | CCCCCCCCCC[C@H](O)[C@@H]1CC[C@@H]([C@H](O)CCCCC[C@@H](O)CCCC[C@H](O)CCC[C@H](O)CC2=C[C@@H](C)OC2=O)O1 |
| InChI | InChI=1S/C37H68O8/c1-3-4-5-6-7-8-9-12-22-33(41)35-24-25-36(45-35)34(42)23-13-10-11-17-30(38)18-14-15-19-31(39)20-16-21-32(40)27-29-26-28(2)44-37(29)43/h26,28,30-36,38-42H,3-25,27H2,1-2H3/t28-,30-,31+,32+,33+,34-,35+,36+/m1/s1 |
| InChIKey | IXSHKIWENQCBDU-ANHPSQLFSA-N |
| XLogP | 6.81 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.94 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|