C50H100O11 — CID 162959723
(E,2R,3R,11R,15R,19R,23R,27S,31S,35S)-3,7,11,15,19,23,27,31,35,39-decamethyltetracont-6-ene-1,2,3,11,15,19,23,27,31,35,39-undecol (PubChem CID 162959723) has the molecular formula C50H100O11 and a molecular weight of 877.34 g/mol. Its IUPAC name is (E,2R,3R,11R,15R,19R,23R,27S,31S,35S)-3,7,11,15,19,23,27,31,35,39-decamethyltetracont-6-ene-1,2,3,11,15,19,23,27,31,35,39-undecol.
| Compound Name | (E,2R,3R,11R,15R,19R,23R,27S,31S,35S)-3,7,11,15,19,23,27,31,35,39-decamethyltetracont-6-ene-1,2,3,11,15,19,23,27,31,35,39-undecol |
|---|---|
| PubChem CID | 162959723 |
| Molecular Formula | C50H100O11 |
| Molecular Weight | 877.34 g/mol |
| Exact Mass | 876.73 |
| IUPAC Name | (E,2R,3R,11R,15R,19R,23R,27S,31S,35S)-3,7,11,15,19,23,27,31,35,39-decamethyltetracont-6-ene-1,2,3,11,15,19,23,27,31,35,39-undecol |
| SMILES | C/C(=C\CC[C@@](C)(O)[C@H](O)CO)CCC[C@@](C)(O)CCC[C@@](C)(O)CCC[C@@](C)(O)CCC[C@@](C)(O)CCC[C@@](C)(O)CCC[C@@](C)(O)CCC[C@@](C)(O)CCCC(C)(C)O |
| InChI | InChI=1S/C50H100O11/c1-40(22-13-38-50(11,61)41(52)39-51)21-12-24-43(4,54)26-15-28-45(6,56)30-17-32-47(8,58)34-19-36-49(10,60)37-20-35-48(9,59)33-18-31-46(7,57)29-16-27-44(5,55)25-14-23-42(2,3)53/h22,41,51-61H,12-21,23-39H2,1-11H3/b40-22+/t41-,43-,44+,45-,46+,47-,48+,49-,50-/m1/s1 |
| InChIKey | FZPHRFPCTITMCH-OJBFTZDKSA-N |
| XLogP | 8.21 |
| TPSA | 222.53 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.34 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|