C12H15Br3O5 — CID 162959838
[(1S)-1-[(5R)-4-bromo-5-(dibromomethyl)-5-methoxy-2-oxofuran-3-yl]butyl] acetate (PubChem CID 162959838) has the molecular formula C12H15Br3O5 and a molecular weight of 478.96 g/mol. Its IUPAC name is [(1S)-1-[(5R)-4-bromo-5-(dibromomethyl)-5-methoxy-2-oxofuran-3-yl]butyl] acetate.
| Compound Name | [(1S)-1-[(5R)-4-bromo-5-(dibromomethyl)-5-methoxy-2-oxofuran-3-yl]butyl] acetate |
|---|---|
| PubChem CID | 162959838 |
| Molecular Formula | C12H15Br3O5 |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 475.85 |
| IUPAC Name | [(1S)-1-[(5R)-4-bromo-5-(dibromomethyl)-5-methoxy-2-oxofuran-3-yl]butyl] acetate |
| SMILES | CCC[C@H](OC(C)=O)C1=C(Br)[C@](OC)(C(Br)Br)OC1=O |
| InChI | InChI=1S/C12H15Br3O5/c1-4-5-7(19-6(2)16)8-9(13)12(18-3,11(14)15)20-10(8)17/h7,11H,4-5H2,1-3H3/t7-,12+/m0/s1 |
| InChIKey | MSGJXJIOEUCWTA-JVXZTZIISA-N |
| XLogP | 3.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|