C20H24O12 — CID 162959936
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-6-oxopyran-4-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 162959936) has the molecular formula C20H24O12 and a molecular weight of 456.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-6-oxopyran-4-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-6-oxopyran-4-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162959936 |
| Molecular Formula | C20H24O12 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-6-oxopyran-4-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(C)oc(=O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H24O12/c1-9-6-14(7-16(25)27-9)31-20-19(30-13(5)24)18(29-12(4)23)17(28-11(3)22)15(32-20)8-26-10(2)21/h6-7,15,17-20H,8H2,1-5H3/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | HGQDVTBUGONPNS-XIKSMUEASA-N |
| XLogP | 0.41 |
| TPSA | 153.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|