C23H30O5 — CID 162960106
5,7-dihydroxy-1',2,2-trimethyl-8-(3-methylbutanoyl)spiro[4H-chromene-3,4'-cyclohexene]-6-carbaldehyde (PubChem CID 162960106) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 5,7-dihydroxy-1',2,2-trimethyl-8-(3-methylbutanoyl)spiro[4H-chromene-3,4'-cyclohexene]-6-carbaldehyde.
| Compound Name | 5,7-dihydroxy-1',2,2-trimethyl-8-(3-methylbutanoyl)spiro[4H-chromene-3,4'-cyclohexene]-6-carbaldehyde |
|---|---|
| PubChem CID | 162960106 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 5,7-dihydroxy-1',2,2-trimethyl-8-(3-methylbutanoyl)spiro[4H-chromene-3,4'-cyclohexene]-6-carbaldehyde |
| SMILES | CC1=CCC2(CC1)Cc1c(O)c(C=O)c(O)c(C(=O)CC(C)C)c1OC2(C)C |
| InChI | InChI=1S/C23H30O5/c1-13(2)10-17(25)18-20(27)16(12-24)19(26)15-11-23(8-6-14(3)7-9-23)22(4,5)28-21(15)18/h6,12-13,26-27H,7-11H2,1-5H3 |
| InChIKey | UTQZAZCYMKJKLX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|