C19H26O6 — CID 162960665
dimethyl (3aR,4R,5S,7aR)-3a-methyl-5-[(Z)-2-methylbut-2-enoyl]oxy-1,4,5,6,7,7a-hexahydroindene-2,4-dicarboxylate (PubChem CID 162960665) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is dimethyl (3aR,4R,5S,7aR)-3a-methyl-5-[(Z)-2-methylbut-2-enoyl]oxy-1,4,5,6,7,7a-hexahydroindene-2,4-dicarboxylate.
| Compound Name | dimethyl (3aR,4R,5S,7aR)-3a-methyl-5-[(Z)-2-methylbut-2-enoyl]oxy-1,4,5,6,7,7a-hexahydroindene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 162960665 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | dimethyl (3aR,4R,5S,7aR)-3a-methyl-5-[(Z)-2-methylbut-2-enoyl]oxy-1,4,5,6,7,7a-hexahydroindene-2,4-dicarboxylate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CC[C@@H]2CC(C(=O)OC)=C[C@]2(C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H26O6/c1-6-11(2)16(20)25-14-8-7-13-9-12(17(21)23-4)10-19(13,3)15(14)18(22)24-5/h6,10,13-15H,7-9H2,1-5H3/b11-6-/t13-,14+,15-,19+/m1/s1 |
| InChIKey | GTQAUWWSOKGAGH-REPNLMGLSA-N |
| XLogP | 2.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|