C13H18O4 — CID 162960675
(3Z,6S,7R)-6,7-dihydroxy-3-pentylidene-4,5,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 162960675) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (3Z,6S,7R)-6,7-dihydroxy-3-pentylidene-4,5,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3Z,6S,7R)-6,7-dihydroxy-3-pentylidene-4,5,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 162960675 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3Z,6S,7R)-6,7-dihydroxy-3-pentylidene-4,5,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | CCCC/C=C1\OC(=O)C2=C1CC[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C13H18O4/c1-2-3-4-5-10-8-6-7-9(14)12(15)11(8)13(16)17-10/h5,9,12,14-15H,2-4,6-7H2,1H3/b10-5-/t9-,12-/m0/s1 |
| InChIKey | RPQMMYCOKKAFTQ-WSDNMOEQSA-N |
| XLogP | 1.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|