C38H58O4 — CID 162961129
[(9Z,12Z)-octadeca-9,12-dienyl] (9R,10E,16Z)-9-acetyloxyoctadeca-10,16-dien-12,14-diynoate (PubChem CID 162961129) has the molecular formula C38H58O4 and a molecular weight of 578.88 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] (9R,10E,16Z)-9-acetyloxyoctadeca-10,16-dien-12,14-diynoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] (9R,10E,16Z)-9-acetyloxyoctadeca-10,16-dien-12,14-diynoate |
|---|---|
| PubChem CID | 162961129 |
| Molecular Formula | C38H58O4 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.43 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] (9R,10E,16Z)-9-acetyloxyoctadeca-10,16-dien-12,14-diynoate |
| SMILES | C/C=C\C#CC#C/C=C/[C@@H](CCCCCCCC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC)OC(C)=O |
| InChI | InChI=1S/C38H58O4/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-22-27-31-35-41-38(40)34-30-26-23-25-29-33-37(42-36(3)39)32-28-24-21-11-9-7-5-2/h5,7,12-13,15-16,28,32,37H,4,6,8,10,14,17-20,22-23,25-27,29-31,33-35H2,1-3H3/b7-5-,13-12-,16-15-,32-28+/t37-/m0/s1 |
| InChIKey | SYBXHKPNOOTSRG-YUHDQEDHSA-N |
| XLogP | 10.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|