C21H26O5 — CID 162961441
[(3S)-2-(5-methoxy-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylhepta-1,5-dien-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 162961441) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is [(3S)-2-(5-methoxy-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylhepta-1,5-dien-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(3S)-2-(5-methoxy-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylhepta-1,5-dien-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162961441 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(3S)-2-(5-methoxy-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylhepta-1,5-dien-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C(C1=CC(=O)C(C)=C(OC)C1=O)[C@H](CC=C(C)C)OC(=O)/C(C)=C/C |
| InChI | InChI=1S/C21H26O5/c1-8-13(4)21(24)26-18(10-9-12(2)3)14(5)16-11-17(22)15(6)20(25-7)19(16)23/h8-9,11,18H,5,10H2,1-4,6-7H3/b13-8+/t18-/m0/s1 |
| InChIKey | YFAZZIGYKCIRKY-RORWEDLISA-N |
| XLogP | 3.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|