C14H26O7 — CID 162961456
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[(E,6S)-6-hydroxy-2-methylhept-2-enoxy]oxane-3,4,5-triol (PubChem CID 162961456) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[(E,6S)-6-hydroxy-2-methylhept-2-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[(E,6S)-6-hydroxy-2-methylhept-2-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162961456 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[(E,6S)-6-hydroxy-2-methylhept-2-enoxy]oxane-3,4,5-triol |
| SMILES | C/C(=C\CC[C@H](C)O)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H26O7/c1-8(4-3-5-9(2)16)7-20-14-13(19)12(18)11(17)10(6-15)21-14/h4,9-19H,3,5-7H2,1-2H3/b8-4+/t9-,10+,11-,12-,13+,14+/m0/s1 |
| InChIKey | RYOZPJPMEMWLIF-ZSZGEUOJSA-N |
| XLogP | -1.09 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|