C16H26 — CID 162961670
cis-(1R,2R)-1-methyl-4-propan-2-ylidene-1,2-bis(prop-1-en-2-yl)cyclohexane (PubChem CID 162961670) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is cis-(1R,2R)-1-methyl-4-propan-2-ylidene-1,2-bis(prop-1-en-2-yl)cyclohexane.
| Compound Name | cis-(1R,2R)-1-methyl-4-propan-2-ylidene-1,2-bis(prop-1-en-2-yl)cyclohexane |
|---|---|
| PubChem CID | 162961670 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | cis-(1R,2R)-1-methyl-4-propan-2-ylidene-1,2-bis(prop-1-en-2-yl)cyclohexane |
| SMILES | C=C(C)[C@H]1CC(=C(C)C)CC[C@@]1(C)C(=C)C |
| InChI | InChI=1S/C16H26/c1-11(2)14-8-9-16(7,13(5)6)15(10-14)12(3)4/h15H,3,5,8-10H2,1-2,4,6-7H3/t15-,16+/m1/s1 |
| InChIKey | RVOXATXFYDNXRE-CVEARBPZSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|