C29H46O5 — CID 162962832
(2S,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,5,10-trihydroxy-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 162962832) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is (2S,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,5,10-trihydroxy-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | (2S,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,5,10-trihydroxy-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 162962832 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | (2S,4aR,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,5,10-trihydroxy-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@@](C)(O)CC[C@]5(C(=O)O)[C@@H](O)C[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H46O5/c1-24(2)19-9-12-27(5)20(26(19,4)11-10-21(24)30)8-7-17-18-15-25(3,34)13-14-29(18,23(32)33)22(31)16-28(17,27)6/h7,18-22,30-31,34H,8-16H2,1-6H3,(H,32,33)/t18-,19-,20+,21-,22-,25-,26-,27+,28+,29+/m0/s1 |
| InChIKey | KDGLSBBFUBIUBL-FSFJONMBSA-N |
| XLogP | 4.93 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|