C33H45N3O5 — CID 162963692
(3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 162963692) has the molecular formula C33H45N3O5 and a molecular weight of 563.74 g/mol. Its IUPAC name is (3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 162963692 |
| Molecular Formula | C33H45N3O5 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | (3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@H]1CC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C33H45N3O5/c1-5-7-14-23(4)28-21-29(37)34-26(19-24-15-10-8-11-16-24)31(38)35-27(20-25-17-12-9-13-18-25)32(39)36-30(22(3)6-2)33(40)41-28/h8-13,15-18,22-23,26-28,30H,5-7,14,19-21H2,1-4H3,(H,34,37)(H,35,38)(H,36,39)/t22-,23-,26-,27-,28+,30+/m0/s1 |
| InChIKey | ALDJPDCIFHQIAL-XVXWBGNPSA-N |
| XLogP | 4.11 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |