C19H30O4 — CID 162964302
methyl 8-[(1S,5R)-5-[(E,2R)-2-hydroxypent-3-enyl]-4-oxocyclopent-2-en-1-yl]octanoate (PubChem CID 162964302) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is methyl 8-[(1S,5R)-5-[(E,2R)-2-hydroxypent-3-enyl]-4-oxocyclopent-2-en-1-yl]octanoate.
| Compound Name | methyl 8-[(1S,5R)-5-[(E,2R)-2-hydroxypent-3-enyl]-4-oxocyclopent-2-en-1-yl]octanoate |
|---|---|
| PubChem CID | 162964302 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | methyl 8-[(1S,5R)-5-[(E,2R)-2-hydroxypent-3-enyl]-4-oxocyclopent-2-en-1-yl]octanoate |
| SMILES | C/C=C/[C@H](O)C[C@H]1C(=O)C=C[C@@H]1CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H30O4/c1-3-9-16(20)14-17-15(12-13-18(17)21)10-7-5-4-6-8-11-19(22)23-2/h3,9,12-13,15-17,20H,4-8,10-11,14H2,1-2H3/b9-3+/t15-,16-,17+/m0/s1 |
| InChIKey | IXFHTAICVWTTRD-VZLJRYABSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|