C17H33N — CID 162964490
(5S,6R,8R,8aS)-6,8-diethyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 162964490) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is (5S,6R,8R,8aS)-6,8-diethyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (5S,6R,8R,8aS)-6,8-diethyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 162964490 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (5S,6R,8R,8aS)-6,8-diethyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCCCC[C@H]1[C@H](CC)C[C@@H](CC)[C@@H]2CCCN12 |
| InChI | InChI=1S/C17H33N/c1-4-7-8-10-16-14(5-2)13-15(6-3)17-11-9-12-18(16)17/h14-17H,4-13H2,1-3H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | CWJWDXLGJFRHSV-NCOADZHNSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|